C15H17Cl2NO2S — CID 153451938
3-chloro-6-[2-chloro-4-(methylsulfanylmethoxy)phenyl]-1-ethyl-3,4-dihydropyridin-2-one (PubChem CID 153451938) has the molecular formula C15H17Cl2NO2S and a molecular weight of 346.28 g/mol. Its IUPAC name is 3-chloro-6-[2-chloro-4-(methylsulfanylmethoxy)phenyl]-1-ethyl-3,4-dihydropyridin-2-one.
| Compound Name | 3-chloro-6-[2-chloro-4-(methylsulfanylmethoxy)phenyl]-1-ethyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153451938 |
| Molecular Formula | C15H17Cl2NO2S |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 3-chloro-6-[2-chloro-4-(methylsulfanylmethoxy)phenyl]-1-ethyl-3,4-dihydropyridin-2-one |
| SMILES | CCN1C(=O)C(Cl)CC=C1c1ccc(OCSC)cc1Cl |
| InChI | InChI=1S/C15H17Cl2NO2S/c1-3-18-14(7-6-12(16)15(18)19)11-5-4-10(8-13(11)17)20-9-21-2/h4-5,7-8,12H,3,6,9H2,1-2H3 |
| InChIKey | WUTKZQOQZRUNTP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|