C16H20ClNO3 — CID 153451275
3-chloro-1-ethyl-6-[4-(methoxymethoxy)-2-methylphenyl]-3,4-dihydropyridin-2-one (PubChem CID 153451275) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is 3-chloro-1-ethyl-6-[4-(methoxymethoxy)-2-methylphenyl]-3,4-dihydropyridin-2-one.
| Compound Name | 3-chloro-1-ethyl-6-[4-(methoxymethoxy)-2-methylphenyl]-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153451275 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 3-chloro-1-ethyl-6-[4-(methoxymethoxy)-2-methylphenyl]-3,4-dihydropyridin-2-one |
| SMILES | CCN1C(=O)C(Cl)CC=C1c1ccc(OCOC)cc1C |
| InChI | InChI=1S/C16H20ClNO3/c1-4-18-15(8-7-14(17)16(18)19)13-6-5-12(9-11(13)2)21-10-20-3/h5-6,8-9,14H,4,7,10H2,1-3H3 |
| InChIKey | JRSCMFNSYNXSKM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|