C15H15Br2F2NO3 — CID 153451001
3-bromo-6-[2-bromo-4-(methoxymethoxy)phenyl]-1-(2,2-difluoroethyl)-3,4-dihydropyridin-2-one (PubChem CID 153451001) has the molecular formula C15H15Br2F2NO3 and a molecular weight of 455.09 g/mol. Its IUPAC name is 3-bromo-6-[2-bromo-4-(methoxymethoxy)phenyl]-1-(2,2-difluoroethyl)-3,4-dihydropyridin-2-one.
| Compound Name | 3-bromo-6-[2-bromo-4-(methoxymethoxy)phenyl]-1-(2,2-difluoroethyl)-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153451001 |
| Molecular Formula | C15H15Br2F2NO3 |
| Molecular Weight | 455.09 g/mol |
| Exact Mass | 452.94 |
| IUPAC Name | 3-bromo-6-[2-bromo-4-(methoxymethoxy)phenyl]-1-(2,2-difluoroethyl)-3,4-dihydropyridin-2-one |
| SMILES | COCOc1ccc(C2=CCC(Br)C(=O)N2CC(F)F)c(Br)c1 |
| InChI | InChI=1S/C15H15Br2F2NO3/c1-22-8-23-9-2-3-10(12(17)6-9)13-5-4-11(16)15(21)20(13)7-14(18)19/h2-3,5-6,11,14H,4,7-8H2,1H3 |
| InChIKey | QZUHQBGPADCZJN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.09 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|