C17H16F2INO2 — CID 153451508
1-(2,2-difluoroethyl)-3-iodo-6-(2-methyl-4-prop-2-ynoxyphenyl)-3,4-dihydropyridin-2-one (PubChem CID 153451508) has the molecular formula C17H16F2INO2 and a molecular weight of 431.22 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-iodo-6-(2-methyl-4-prop-2-ynoxyphenyl)-3,4-dihydropyridin-2-one.
| Compound Name | 1-(2,2-difluoroethyl)-3-iodo-6-(2-methyl-4-prop-2-ynoxyphenyl)-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153451508 |
| Molecular Formula | C17H16F2INO2 |
| Molecular Weight | 431.22 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-iodo-6-(2-methyl-4-prop-2-ynoxyphenyl)-3,4-dihydropyridin-2-one |
| SMILES | C#CCOc1ccc(C2=CCC(I)C(=O)N2CC(F)F)c(C)c1 |
| InChI | InChI=1S/C17H16F2INO2/c1-3-8-23-12-4-5-13(11(2)9-12)15-7-6-14(20)17(22)21(15)10-16(18)19/h1,4-5,7,9,14,16H,6,8,10H2,2H3 |
| InChIKey | JMPQBZZASUGVSU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|