C17H16F2NO2Y- — CID 153452001
6-(4-but-2-ynoxy-2,6-difluorophenyl)-1-ethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153452001) has the molecular formula C17H16F2NO2Y- and a molecular weight of 393.22 g/mol. Its IUPAC name is 6-(4-but-2-ynoxy-2,6-difluorophenyl)-1-ethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 6-(4-but-2-ynoxy-2,6-difluorophenyl)-1-ethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153452001 |
| Molecular Formula | C17H16F2NO2Y- |
| Molecular Weight | 393.22 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 6-(4-but-2-ynoxy-2,6-difluorophenyl)-1-ethyl-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | CC#CCOc1cc(F)c(C2=[C-]CCC(=O)N2CC)c(F)c1.[Y] |
| InChI | InChI=1S/C17H16F2NO2.Y/c1-3-5-9-22-12-10-13(18)17(14(19)11-12)15-7-6-8-16(21)20(15)4-2;/h10-11H,4,6,8-9H2,1-2H3;/q-1; |
| InChIKey | GTAAJJQDINTRDI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|