C15H15F3NO2Y- — CID 153451775
1-(2,2-difluoroethyl)-6-(4-ethoxy-2-fluorophenyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153451775) has the molecular formula C15H15F3NO2Y- and a molecular weight of 387.19 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-6-(4-ethoxy-2-fluorophenyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 1-(2,2-difluoroethyl)-6-(4-ethoxy-2-fluorophenyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153451775 |
| Molecular Formula | C15H15F3NO2Y- |
| Molecular Weight | 387.19 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 1-(2,2-difluoroethyl)-6-(4-ethoxy-2-fluorophenyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | CCOc1ccc(C2=[C-]CCC(=O)N2CC(F)F)c(F)c1.[Y] |
| InChI | InChI=1S/C15H15F3NO2.Y/c1-2-21-10-6-7-11(12(16)8-10)13-4-3-5-15(20)19(13)9-14(17)18;/h6-8,14H,2-3,5,9H2,1H3;/q-1; |
| InChIKey | TYGSZPVJLWYXEG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.19 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|