C17H14F3INO2Y- — CID 153451949
6-(4-but-2-ynoxy-2-fluorophenyl)-1-(2,2-difluoroethyl)-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153451949) has the molecular formula C17H14F3INO2Y- and a molecular weight of 537.11 g/mol. Its IUPAC name is 6-(4-but-2-ynoxy-2-fluorophenyl)-1-(2,2-difluoroethyl)-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 6-(4-but-2-ynoxy-2-fluorophenyl)-1-(2,2-difluoroethyl)-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153451949 |
| Molecular Formula | C17H14F3INO2Y- |
| Molecular Weight | 537.11 g/mol |
| Exact Mass | 536.91 |
| IUPAC Name | 6-(4-but-2-ynoxy-2-fluorophenyl)-1-(2,2-difluoroethyl)-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | CC#CCOc1ccc(C2=[C-]CC(I)C(=O)N2CC(F)F)c(F)c1.[Y] |
| InChI | InChI=1S/C17H14F3INO2.Y/c1-2-3-8-24-11-4-5-12(13(18)9-11)15-7-6-14(21)17(23)22(15)10-16(19)20;/h4-5,9,14,16H,6,8,10H2,1H3;/q-1; |
| InChIKey | ACFAHVTWTUXTBX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.11 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|