C15H11BrF2IN2O2Y- — CID 153450602
2-[3-bromo-4-[1-(2,2-difluoroethyl)-5-iodo-6-oxo-4,5-dihydro-3H-pyridin-3-id-2-yl]phenoxy]acetonitrile;yttrium (PubChem CID 153450602) has the molecular formula C15H11BrF2IN2O2Y- and a molecular weight of 584.98 g/mol. Its IUPAC name is 2-[3-bromo-4-[1-(2,2-difluoroethyl)-5-iodo-6-oxo-4,5-dihydro-3H-pyridin-3-id-2-yl]phenoxy]acetonitrile;yttrium.
| Compound Name | 2-[3-bromo-4-[1-(2,2-difluoroethyl)-5-iodo-6-oxo-4,5-dihydro-3H-pyridin-3-id-2-yl]phenoxy]acetonitrile;yttrium |
|---|---|
| PubChem CID | 153450602 |
| Molecular Formula | C15H11BrF2IN2O2Y- |
| Molecular Weight | 584.98 g/mol |
| Exact Mass | 583.81 |
| IUPAC Name | 2-[3-bromo-4-[1-(2,2-difluoroethyl)-5-iodo-6-oxo-4,5-dihydro-3H-pyridin-3-id-2-yl]phenoxy]acetonitrile;yttrium |
| SMILES | N#CCOc1ccc(C2=[C-]CC(I)C(=O)N2CC(F)F)c(Br)c1.[Y] |
| InChI | InChI=1S/C15H11BrF2IN2O2.Y/c16-11-7-9(23-6-5-20)1-2-10(11)13-4-3-12(19)15(22)21(13)8-14(17)18;/h1-2,7,12,14H,3,6,8H2;/q-1; |
| InChIKey | WZRHMERENBEDHF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.98 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|