C15H10BrF2N2O2Y- — CID 162035495
2-[3-bromo-4-[1-(2,2-difluoroethyl)-6-oxo-3H-pyridin-3-id-2-yl]phenoxy]acetonitrile;yttrium (PubChem CID 162035495) has the molecular formula C15H10BrF2N2O2Y- and a molecular weight of 457.06 g/mol. Its IUPAC name is 2-[3-bromo-4-[1-(2,2-difluoroethyl)-6-oxo-3H-pyridin-3-id-2-yl]phenoxy]acetonitrile;yttrium.
| Compound Name | 2-[3-bromo-4-[1-(2,2-difluoroethyl)-6-oxo-3H-pyridin-3-id-2-yl]phenoxy]acetonitrile;yttrium |
|---|---|
| PubChem CID | 162035495 |
| Molecular Formula | C15H10BrF2N2O2Y- |
| Molecular Weight | 457.06 g/mol |
| Exact Mass | 455.90 |
| IUPAC Name | 2-[3-bromo-4-[1-(2,2-difluoroethyl)-6-oxo-3H-pyridin-3-id-2-yl]phenoxy]acetonitrile;yttrium |
| SMILES | N#CCOc1ccc(-c2[c-]ccc(=O)n2CC(F)F)c(Br)c1.[Y] |
| InChI | InChI=1S/C15H10BrF2N2O2.Y/c16-12-8-10(22-7-6-19)4-5-11(12)13-2-1-3-15(21)20(13)9-14(17)18;/h1,3-5,8,14H,7,9H2;/q-1; |
| InChIKey | PMONFMIAWTUSLK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.06 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|