C17H18FINO2Y- — CID 153451951
6-[4-(cyclopropylmethoxy)-2-fluorophenyl]-1-ethyl-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153451951) has the molecular formula C17H18FINO2Y- and a molecular weight of 503.14 g/mol. Its IUPAC name is 6-[4-(cyclopropylmethoxy)-2-fluorophenyl]-1-ethyl-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 6-[4-(cyclopropylmethoxy)-2-fluorophenyl]-1-ethyl-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153451951 |
| Molecular Formula | C17H18FINO2Y- |
| Molecular Weight | 503.14 g/mol |
| Exact Mass | 502.94 |
| IUPAC Name | 6-[4-(cyclopropylmethoxy)-2-fluorophenyl]-1-ethyl-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | CCN1C(=O)C(I)C[C-]=C1c1ccc(OCC2CC2)cc1F.[Y] |
| InChI | InChI=1S/C17H18FINO2.Y/c1-2-20-16(8-7-15(19)17(20)21)13-6-5-12(9-14(13)18)22-10-11-3-4-11;/h5-6,9,11,15H,2-4,7,10H2,1H3;/q-1; |
| InChIKey | JTJLECIBNORZBC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.14 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|