C16H16ClINO2Y- — CID 153451427
6-(2-chloro-4-prop-2-enoxyphenyl)-1-ethyl-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153451427) has the molecular formula C16H16ClINO2Y- and a molecular weight of 505.57 g/mol. Its IUPAC name is 6-(2-chloro-4-prop-2-enoxyphenyl)-1-ethyl-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 6-(2-chloro-4-prop-2-enoxyphenyl)-1-ethyl-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153451427 |
| Molecular Formula | C16H16ClINO2Y- |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 504.90 |
| IUPAC Name | 6-(2-chloro-4-prop-2-enoxyphenyl)-1-ethyl-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | C=CCOc1ccc(C2=[C-]CC(I)C(=O)N2CC)c(Cl)c1.[Y] |
| InChI | InChI=1S/C16H16ClINO2.Y/c1-3-9-21-11-5-6-12(13(17)10-11)15-8-7-14(18)16(20)19(15)4-2;/h3,5-6,10,14H,1,4,7,9H2,2H3;/q-1; |
| InChIKey | AKVJXBNXOAGAFJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|