C14H15INO2Y- — CID 153451967
1-ethyl-3-iodo-6-(4-methoxyphenyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153451967) has the molecular formula C14H15INO2Y- and a molecular weight of 445.09 g/mol. Its IUPAC name is 1-ethyl-3-iodo-6-(4-methoxyphenyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 1-ethyl-3-iodo-6-(4-methoxyphenyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153451967 |
| Molecular Formula | C14H15INO2Y- |
| Molecular Weight | 445.09 g/mol |
| Exact Mass | 444.92 |
| IUPAC Name | 1-ethyl-3-iodo-6-(4-methoxyphenyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | CCN1C(=O)C(I)C[C-]=C1c1ccc(OC)cc1.[Y] |
| InChI | InChI=1S/C14H15INO2.Y/c1-3-16-13(9-8-12(15)14(16)17)10-4-6-11(18-2)7-5-10;/h4-7,12H,3,8H2,1-2H3;/q-1; |
| InChIKey | MLVGNWPIPNVXGV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.09 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|