C13H9F4INOY- — CID 153451765
1-(2,2-difluoroethyl)-6-(2,6-difluorophenyl)-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153451765) has the molecular formula C13H9F4INOY- and a molecular weight of 487.02 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-6-(2,6-difluorophenyl)-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 1-(2,2-difluoroethyl)-6-(2,6-difluorophenyl)-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153451765 |
| Molecular Formula | C13H9F4INOY- |
| Molecular Weight | 487.02 g/mol |
| Exact Mass | 486.87 |
| IUPAC Name | 1-(2,2-difluoroethyl)-6-(2,6-difluorophenyl)-3-iodo-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | O=C1C(I)C[C-]=C(c2c(F)cccc2F)N1CC(F)F.[Y] |
| InChI | InChI=1S/C13H9F4INO.Y/c14-7-2-1-3-8(15)12(7)10-5-4-9(18)13(20)19(10)6-11(16)17;/h1-3,9,11H,4,6H2;/q-1; |
| InChIKey | RENMKCILORUUOJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.02 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|