C15H16F2NO2SY- — CID 153452049
1-(2,2-difluoroethyl)-6-[4-(methylsulfanylmethoxy)phenyl]-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153452049) has the molecular formula C15H16F2NO2SY- and a molecular weight of 401.27 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-6-[4-(methylsulfanylmethoxy)phenyl]-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 1-(2,2-difluoroethyl)-6-[4-(methylsulfanylmethoxy)phenyl]-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153452049 |
| Molecular Formula | C15H16F2NO2SY- |
| Molecular Weight | 401.27 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | 1-(2,2-difluoroethyl)-6-[4-(methylsulfanylmethoxy)phenyl]-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | CSCOc1ccc(C2=[C-]CCC(=O)N2CC(F)F)cc1.[Y] |
| InChI | InChI=1S/C15H16F2NO2S.Y/c1-21-10-20-12-7-5-11(6-8-12)13-3-2-4-15(19)18(13)9-14(16)17;/h5-8,14H,2,4,9-10H2,1H3;/q-1; |
| InChIKey | JQFUTWUKIRYNJY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|