C16H16F2NOY- — CID 159935289
2-[4-(2,2-difluoroethoxy)phenyl]-1-ethyl-6-methylidene-3H-pyridin-3-ide;yttrium (PubChem CID 159935289) has the molecular formula C16H16F2NOY- and a molecular weight of 365.21 g/mol. Its IUPAC name is 2-[4-(2,2-difluoroethoxy)phenyl]-1-ethyl-6-methylidene-3H-pyridin-3-ide;yttrium.
| Compound Name | 2-[4-(2,2-difluoroethoxy)phenyl]-1-ethyl-6-methylidene-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 159935289 |
| Molecular Formula | C16H16F2NOY- |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 2-[4-(2,2-difluoroethoxy)phenyl]-1-ethyl-6-methylidene-3H-pyridin-3-ide;yttrium |
| SMILES | C=C1C=C[C-]=C(c2ccc(OCC(F)F)cc2)N1CC.[Y] |
| InChI | InChI=1S/C16H16F2NO.Y/c1-3-19-12(2)5-4-6-15(19)13-7-9-14(10-8-13)20-11-16(17)18;/h4-5,7-10,16H,2-3,11H2,1H3;/q-1; |
| InChIKey | TZXPWZXIIJDBPA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|