C14H14F2NOY- — CID 161280183
6-[4-(2,2-difluoroethoxy)phenyl]-2-methylidene-1,3,4,5-tetrahydropyridin-5-ide;yttrium (PubChem CID 161280183) has the molecular formula C14H14F2NOY- and a molecular weight of 339.17 g/mol. Its IUPAC name is 6-[4-(2,2-difluoroethoxy)phenyl]-2-methylidene-1,3,4,5-tetrahydropyridin-5-ide;yttrium.
| Compound Name | 6-[4-(2,2-difluoroethoxy)phenyl]-2-methylidene-1,3,4,5-tetrahydropyridin-5-ide;yttrium |
|---|---|
| PubChem CID | 161280183 |
| Molecular Formula | C14H14F2NOY- |
| Molecular Weight | 339.17 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 6-[4-(2,2-difluoroethoxy)phenyl]-2-methylidene-1,3,4,5-tetrahydropyridin-5-ide;yttrium |
| SMILES | C=C1CC[C-]=C(c2ccc(OCC(F)F)cc2)N1.[Y] |
| InChI | InChI=1S/C14H14F2NO.Y/c1-10-3-2-4-13(17-10)11-5-7-12(8-6-11)18-9-14(15)16;/h5-8,14,17H,1-3,9H2;/q-1; |
| InChIKey | YNZWISMALZXMOG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.17 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|