C15H18NOY- — CID 147813194
6-(4-ethoxyphenyl)-3-methyl-2-methylidene-1,3,4,5-tetrahydropyridin-5-ide;yttrium (PubChem CID 147813194) has the molecular formula C15H18NOY- and a molecular weight of 317.22 g/mol. Its IUPAC name is 6-(4-ethoxyphenyl)-3-methyl-2-methylidene-1,3,4,5-tetrahydropyridin-5-ide;yttrium.
| Compound Name | 6-(4-ethoxyphenyl)-3-methyl-2-methylidene-1,3,4,5-tetrahydropyridin-5-ide;yttrium |
|---|---|
| PubChem CID | 147813194 |
| Molecular Formula | C15H18NOY- |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 6-(4-ethoxyphenyl)-3-methyl-2-methylidene-1,3,4,5-tetrahydropyridin-5-ide;yttrium |
| SMILES | C=C1NC(c2ccc(OCC)cc2)=[C-]CC1C.[Y] |
| InChI | InChI=1S/C15H18NO.Y/c1-4-17-14-8-6-13(7-9-14)15-10-5-11(2)12(3)16-15;/h6-9,11,16H,3-5H2,1-2H3;/q-1; |
| InChIKey | QYPUEPUESNVFAD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|