C14H13BrF2NOY- — CID 159204350
3-bromo-6-[4-(2,2-difluoroethoxy)phenyl]-2-methylidene-1,3,4,5-tetrahydropyridin-5-ide;yttrium (PubChem CID 159204350) has the molecular formula C14H13BrF2NOY- and a molecular weight of 418.07 g/mol. Its IUPAC name is 3-bromo-6-[4-(2,2-difluoroethoxy)phenyl]-2-methylidene-1,3,4,5-tetrahydropyridin-5-ide;yttrium.
| Compound Name | 3-bromo-6-[4-(2,2-difluoroethoxy)phenyl]-2-methylidene-1,3,4,5-tetrahydropyridin-5-ide;yttrium |
|---|---|
| PubChem CID | 159204350 |
| Molecular Formula | C14H13BrF2NOY- |
| Molecular Weight | 418.07 g/mol |
| Exact Mass | 416.92 |
| IUPAC Name | 3-bromo-6-[4-(2,2-difluoroethoxy)phenyl]-2-methylidene-1,3,4,5-tetrahydropyridin-5-ide;yttrium |
| SMILES | C=C1NC(c2ccc(OCC(F)F)cc2)=[C-]CC1Br.[Y] |
| InChI | InChI=1S/C14H13BrF2NO.Y/c1-9-12(15)6-7-13(18-9)10-2-4-11(5-3-10)19-8-14(16)17;/h2-5,12,14,18H,1,6,8H2;/q-1; |
| InChIKey | DARRDJKXWKCVQU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.07 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|