C14H14ClF2NO — CID 158431798
3-chloro-6-[4-(2,2-difluoroethoxy)phenyl]-2-methylidene-3,4-dihydro-1H-pyridine (PubChem CID 158431798) has the molecular formula C14H14ClF2NO and a molecular weight of 285.72 g/mol. Its IUPAC name is 3-chloro-6-[4-(2,2-difluoroethoxy)phenyl]-2-methylidene-3,4-dihydro-1H-pyridine.
| Compound Name | 3-chloro-6-[4-(2,2-difluoroethoxy)phenyl]-2-methylidene-3,4-dihydro-1H-pyridine |
|---|---|
| PubChem CID | 158431798 |
| Molecular Formula | C14H14ClF2NO |
| Molecular Weight | 285.72 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 3-chloro-6-[4-(2,2-difluoroethoxy)phenyl]-2-methylidene-3,4-dihydro-1H-pyridine |
| SMILES | C=C1NC(c2ccc(OCC(F)F)cc2)=CCC1Cl |
| InChI | InChI=1S/C14H14ClF2NO/c1-9-12(15)6-7-13(18-9)10-2-4-11(5-3-10)19-8-14(16)17/h2-5,7,12,14,18H,1,6,8H2 |
| InChIKey | HKWKADCFWUPNTP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.72 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|