C15H18ClNO2 — CID 159270423
3-chloro-6-[4-(2-methoxyethoxy)phenyl]-2-methylidene-3,4-dihydro-1H-pyridine (PubChem CID 159270423) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is 3-chloro-6-[4-(2-methoxyethoxy)phenyl]-2-methylidene-3,4-dihydro-1H-pyridine.
| Compound Name | 3-chloro-6-[4-(2-methoxyethoxy)phenyl]-2-methylidene-3,4-dihydro-1H-pyridine |
|---|---|
| PubChem CID | 159270423 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 3-chloro-6-[4-(2-methoxyethoxy)phenyl]-2-methylidene-3,4-dihydro-1H-pyridine |
| SMILES | C=C1NC(c2ccc(OCCOC)cc2)=CCC1Cl |
| InChI | InChI=1S/C15H18ClNO2/c1-11-14(16)7-8-15(17-11)12-3-5-13(6-4-12)19-10-9-18-2/h3-6,8,14,17H,1,7,9-10H2,2H3 |
| InChIKey | GJBOSQPEKOGDKY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|