C15H18O — CID 163557331
1-ethoxy-4-(6-methylcyclohexa-1,3-dien-1-yl)benzene (PubChem CID 163557331) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-ethoxy-4-(6-methylcyclohexa-1,3-dien-1-yl)benzene.
| Compound Name | 1-ethoxy-4-(6-methylcyclohexa-1,3-dien-1-yl)benzene |
|---|---|
| PubChem CID | 163557331 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 1-ethoxy-4-(6-methylcyclohexa-1,3-dien-1-yl)benzene |
| SMILES | CCOc1ccc(C2=CC=CCC2C)cc1 |
| InChI | InChI=1S/C15H18O/c1-3-16-14-10-8-13(9-11-14)15-7-5-4-6-12(15)2/h4-5,7-12H,3,6H2,1-2H3 |
| InChIKey | FOFHZCIPQJEEKK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |