C15H18O — CID 90876959
1-(cyclohexa-2,4-dien-1-ylmethyl)-4-ethoxybenzene (PubChem CID 90876959) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-(cyclohexa-2,4-dien-1-ylmethyl)-4-ethoxybenzene.
| Compound Name | 1-(cyclohexa-2,4-dien-1-ylmethyl)-4-ethoxybenzene |
|---|---|
| PubChem CID | 90876959 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 1-(cyclohexa-2,4-dien-1-ylmethyl)-4-ethoxybenzene |
| SMILES | CCOc1ccc(CC2C=CC=CC2)cc1 |
| InChI | InChI=1S/C15H18O/c1-2-16-15-10-8-14(9-11-15)12-13-6-4-3-5-7-13/h3-6,8-11,13H,2,7,12H2,1H3 |
| InChIKey | JDCDMMQYWMXMCL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |