C13H15N — CID 143707425
3-methyl-5-(6-methylcyclohexa-1,3-dien-1-yl)pyridine (PubChem CID 143707425) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 3-methyl-5-(6-methylcyclohexa-1,3-dien-1-yl)pyridine.
| Compound Name | 3-methyl-5-(6-methylcyclohexa-1,3-dien-1-yl)pyridine |
|---|---|
| PubChem CID | 143707425 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 3-methyl-5-(6-methylcyclohexa-1,3-dien-1-yl)pyridine |
| SMILES | Cc1cncc(C2=CC=CCC2C)c1 |
| InChI | InChI=1S/C13H15N/c1-10-7-12(9-14-8-10)13-6-4-3-5-11(13)2/h3-4,6-9,11H,5H2,1-2H3 |
| InChIKey | XMQHUYDLQXQEMA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |