About CID 174996178
CID 174996178 (PubChem CID 174996178) has the molecular formula C7H9BN
and a molecular weight of 117.97 g/mol.
Molecular Properties
| Compound Name | CID 174996178 |
| PubChem CID | 174996178 |
| Molecular Formula | C7H9BN |
| Molecular Weight | 117.97 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | — |
| SMILES | Cc1cncc(C)c1.[B] |
| InChI | InChI=1S/C7H9N.B/c1-6-3-7(2)5-8-4-6;/h3-5H,1-2H3; |
| InChIKey | PENKIIVFLHKGDK-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.97 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174996178 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174996178?
The IUPAC name of CID 174996178 (CID 174996178) is not available.
What is the SMILES notation for CID 174996178?
The canonical SMILES for CID 174996178 is Cc1cncc(C)c1.[B].
What is the InChIKey of CID 174996178?
The InChIKey is PENKIIVFLHKGDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.B/c1-6-3-7(2)5-8-4-6;/h3-5H,1-2H3;.
What are the key properties of CID 174996178?
CID 174996178 has a molecular weight of 117.97 g/mol, XLogP of 1.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174996178 is sourced from PubChem (CID 174996178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).