About ethane;5-methylpyridine-3-thiol
ethane;5-methylpyridine-3-thiol (PubChem CID 144877949) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is ethane;5-methylpyridine-3-thiol.
Molecular Properties
| Compound Name | ethane;5-methylpyridine-3-thiol |
| PubChem CID | 144877949 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | ethane;5-methylpyridine-3-thiol |
| SMILES | CC.Cc1cncc(S)c1 |
| InChI | InChI=1S/C6H7NS.C2H6/c1-5-2-6(8)4-7-3-5;1-2/h2-4,8H,1H3;1-2H3 |
| InChIKey | DYKHPCCAFOJUIP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-methylpyridine-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methylpyridine-3-thiol?
The IUPAC name of ethane;5-methylpyridine-3-thiol (CID 144877949) is ethane;5-methylpyridine-3-thiol.
What is the SMILES notation for ethane;5-methylpyridine-3-thiol?
The canonical SMILES for ethane;5-methylpyridine-3-thiol is CC.Cc1cncc(S)c1.
What is the InChIKey of ethane;5-methylpyridine-3-thiol?
The InChIKey is DYKHPCCAFOJUIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NS.C2H6/c1-5-2-6(8)4-7-3-5;1-2/h2-4,8H,1H3;1-2H3.
What are the key properties of ethane;5-methylpyridine-3-thiol?
ethane;5-methylpyridine-3-thiol has a molecular weight of 155.27 g/mol, XLogP of 2.70, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methylpyridine-3-thiol is sourced from PubChem (CID 144877949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).