C14H16O — CID 145107392
1-cyclohexa-1,3-dien-1-yl-4-ethoxybenzene (PubChem CID 145107392) has the molecular formula C14H16O and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-yl-4-ethoxybenzene.
| Compound Name | 1-cyclohexa-1,3-dien-1-yl-4-ethoxybenzene |
|---|---|
| PubChem CID | 145107392 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-yl-4-ethoxybenzene |
| SMILES | CCOc1ccc(C2=CC=CCC2)cc1 |
| InChI | InChI=1S/C14H16O/c1-2-15-14-10-8-13(9-11-14)12-6-4-3-5-7-12/h3-4,6,8-11H,2,5,7H2,1H3 |
| InChIKey | HMHNGEVOZKYWQL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |