C16H12F5INOY- — CID 162146799
1-(2,2-difluoroethyl)-5-iodo-6-methylidene-2-[4-(2,2,2-trifluoroethoxy)phenyl]-3H-pyridin-3-ide;yttrium (PubChem CID 162146799) has the molecular formula C16H12F5INOY- and a molecular weight of 545.08 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-5-iodo-6-methylidene-2-[4-(2,2,2-trifluoroethoxy)phenyl]-3H-pyridin-3-ide;yttrium.
| Compound Name | 1-(2,2-difluoroethyl)-5-iodo-6-methylidene-2-[4-(2,2,2-trifluoroethoxy)phenyl]-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 162146799 |
| Molecular Formula | C16H12F5INOY- |
| Molecular Weight | 545.08 g/mol |
| Exact Mass | 544.89 |
| IUPAC Name | 1-(2,2-difluoroethyl)-5-iodo-6-methylidene-2-[4-(2,2,2-trifluoroethoxy)phenyl]-3H-pyridin-3-ide;yttrium |
| SMILES | C=C1C(I)=C[C-]=C(c2ccc(OCC(F)(F)F)cc2)N1CC(F)F.[Y] |
| InChI | InChI=1S/C16H12F5INO.Y/c1-10-13(22)6-7-14(23(10)8-15(17)18)11-2-4-12(5-3-11)24-9-16(19,20)21;/h2-6,15H,1,8-9H2;/q-1; |
| InChIKey | XRVJPVBDSBDXPK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.08 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|