C17H16F2NOY- — CID 160616384
1-(2,2-difluoroethyl)-6-methylidene-2-(4-prop-2-enoxyphenyl)-3H-pyridin-3-ide;yttrium (PubChem CID 160616384) has the molecular formula C17H16F2NOY- and a molecular weight of 377.22 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-6-methylidene-2-(4-prop-2-enoxyphenyl)-3H-pyridin-3-ide;yttrium.
| Compound Name | 1-(2,2-difluoroethyl)-6-methylidene-2-(4-prop-2-enoxyphenyl)-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 160616384 |
| Molecular Formula | C17H16F2NOY- |
| Molecular Weight | 377.22 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 1-(2,2-difluoroethyl)-6-methylidene-2-(4-prop-2-enoxyphenyl)-3H-pyridin-3-ide;yttrium |
| SMILES | C=CCOc1ccc(C2=[C-]C=CC(=C)N2CC(F)F)cc1.[Y] |
| InChI | InChI=1S/C17H16F2NO.Y/c1-3-11-21-15-9-7-14(8-10-15)16-6-4-5-13(2)20(16)12-17(18)19;/h3-5,7-10,17H,1-2,11-12H2;/q-1; |
| InChIKey | XFLBDEHLCKCSIX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.22 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|