C13H10Br2NOY- — CID 159944033
2-(2,4-dibromophenyl)-1,5-dimethyl-3H-pyridin-3-id-6-one;yttrium (PubChem CID 159944033) has the molecular formula C13H10Br2NOY- and a molecular weight of 444.94 g/mol. Its IUPAC name is 2-(2,4-dibromophenyl)-1,5-dimethyl-3H-pyridin-3-id-6-one;yttrium.
| Compound Name | 2-(2,4-dibromophenyl)-1,5-dimethyl-3H-pyridin-3-id-6-one;yttrium |
|---|---|
| PubChem CID | 159944033 |
| Molecular Formula | C13H10Br2NOY- |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 442.82 |
| IUPAC Name | 2-(2,4-dibromophenyl)-1,5-dimethyl-3H-pyridin-3-id-6-one;yttrium |
| SMILES | Cc1c[c-]c(-c2ccc(Br)cc2Br)n(C)c1=O.[Y] |
| InChI | InChI=1S/C13H10Br2NO.Y/c1-8-3-6-12(16(2)13(8)17)10-5-4-9(14)7-11(10)15;/h3-5,7H,1-2H3;/q-1; |
| InChIKey | IUZWSIBIABUMLV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|