C13H13BrClNO2 — CID 153451886
6-(2-bromo-4-methoxyphenyl)-3-chloro-1-methyl-3,4-dihydropyridin-2-one (PubChem CID 153451886) has the molecular formula C13H13BrClNO2 and a molecular weight of 330.61 g/mol. Its IUPAC name is 6-(2-bromo-4-methoxyphenyl)-3-chloro-1-methyl-3,4-dihydropyridin-2-one.
| Compound Name | 6-(2-bromo-4-methoxyphenyl)-3-chloro-1-methyl-3,4-dihydropyridin-2-one |
|---|---|
| PubChem CID | 153451886 |
| Molecular Formula | C13H13BrClNO2 |
| Molecular Weight | 330.61 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 6-(2-bromo-4-methoxyphenyl)-3-chloro-1-methyl-3,4-dihydropyridin-2-one |
| SMILES | COc1ccc(C2=CCC(Cl)C(=O)N2C)c(Br)c1 |
| InChI | InChI=1S/C13H13BrClNO2/c1-16-12(6-5-11(15)13(16)17)9-4-3-8(18-2)7-10(9)14/h3-4,6-7,11H,5H2,1-2H3 |
| InChIKey | YPHGDRBPZRQARJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.61 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|