C16H14ClNO2 — CID 158647541
6-(2-chloro-4-prop-2-ynoxyphenyl)-1,3-dimethylpyridin-2-one (PubChem CID 158647541) has the molecular formula C16H14ClNO2 and a molecular weight of 287.75 g/mol. Its IUPAC name is 6-(2-chloro-4-prop-2-ynoxyphenyl)-1,3-dimethylpyridin-2-one.
| Compound Name | 6-(2-chloro-4-prop-2-ynoxyphenyl)-1,3-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 158647541 |
| Molecular Formula | C16H14ClNO2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 6-(2-chloro-4-prop-2-ynoxyphenyl)-1,3-dimethylpyridin-2-one |
| SMILES | C#CCOc1ccc(-c2ccc(C)c(=O)n2C)c(Cl)c1 |
| InChI | InChI=1S/C16H14ClNO2/c1-4-9-20-12-6-7-13(14(17)10-12)15-8-5-11(2)16(19)18(15)3/h1,5-8,10H,9H2,2-3H3 |
| InChIKey | DEWNVIBOLCGVTD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|