C16H14NO2Y- — CID 146982885
1-methyl-2-(2-methyl-4-prop-2-ynoxyphenyl)-3H-pyridin-3-id-6-one;yttrium (PubChem CID 146982885) has the molecular formula C16H14NO2Y- and a molecular weight of 341.20 g/mol. Its IUPAC name is 1-methyl-2-(2-methyl-4-prop-2-ynoxyphenyl)-3H-pyridin-3-id-6-one;yttrium.
| Compound Name | 1-methyl-2-(2-methyl-4-prop-2-ynoxyphenyl)-3H-pyridin-3-id-6-one;yttrium |
|---|---|
| PubChem CID | 146982885 |
| Molecular Formula | C16H14NO2Y- |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | 1-methyl-2-(2-methyl-4-prop-2-ynoxyphenyl)-3H-pyridin-3-id-6-one;yttrium |
| SMILES | C#CCOc1ccc(-c2[c-]ccc(=O)n2C)c(C)c1.[Y] |
| InChI | InChI=1S/C16H14NO2.Y/c1-4-10-19-13-8-9-14(12(2)11-13)15-6-5-7-16(18)17(15)3;/h1,5,7-9,11H,10H2,2-3H3;/q-1; |
| InChIKey | XICYNFYSLYMLJF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|