C15H17BrNOY- — CID 153450542
3-bromo-1-ethyl-6-(2-ethylphenyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium (PubChem CID 153450542) has the molecular formula C15H17BrNOY- and a molecular weight of 396.12 g/mol. Its IUPAC name is 3-bromo-1-ethyl-6-(2-ethylphenyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium.
| Compound Name | 3-bromo-1-ethyl-6-(2-ethylphenyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
|---|---|
| PubChem CID | 153450542 |
| Molecular Formula | C15H17BrNOY- |
| Molecular Weight | 396.12 g/mol |
| Exact Mass | 394.96 |
| IUPAC Name | 3-bromo-1-ethyl-6-(2-ethylphenyl)-4,5-dihydro-3H-pyridin-5-id-2-one;yttrium |
| SMILES | CCc1ccccc1C1=[C-]CC(Br)C(=O)N1CC.[Y] |
| InChI | InChI=1S/C15H17BrNO.Y/c1-3-11-7-5-6-8-12(11)14-10-9-13(16)15(18)17(14)4-2;/h5-8,13H,3-4,9H2,1-2H3;/q-1; |
| InChIKey | ZOYQFFRTHFDDNA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.12 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|