C17H17ClF3NO2 — CID 161316717
3-chloro-1-(2,2-difluoroethyl)-6-[2-fluoro-4-(2-methoxyethoxy)phenyl]-2-methylidenepyridine (PubChem CID 161316717) has the molecular formula C17H17ClF3NO2 and a molecular weight of 359.78 g/mol. Its IUPAC name is 3-chloro-1-(2,2-difluoroethyl)-6-[2-fluoro-4-(2-methoxyethoxy)phenyl]-2-methylidenepyridine.
| Compound Name | 3-chloro-1-(2,2-difluoroethyl)-6-[2-fluoro-4-(2-methoxyethoxy)phenyl]-2-methylidenepyridine |
|---|---|
| PubChem CID | 161316717 |
| Molecular Formula | C17H17ClF3NO2 |
| Molecular Weight | 359.78 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 3-chloro-1-(2,2-difluoroethyl)-6-[2-fluoro-4-(2-methoxyethoxy)phenyl]-2-methylidenepyridine |
| SMILES | C=C1C(Cl)=CC=C(c2ccc(OCCOC)cc2F)N1CC(F)F |
| InChI | InChI=1S/C17H17ClF3NO2/c1-11-14(18)5-6-16(22(11)10-17(20)21)13-4-3-12(9-15(13)19)24-8-7-23-2/h3-6,9,17H,1,7-8,10H2,2H3 |
| InChIKey | SVHLHFNNSKNJSX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.78 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|