C17H17F3NOSY- — CID 160713949
1-(2,2-difluoroethyl)-2-[2-fluoro-6-(methylsulfanylmethoxy)phenyl]-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium (PubChem CID 160713949) has the molecular formula C17H17F3NOSY- and a molecular weight of 429.30 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-2-[2-fluoro-6-(methylsulfanylmethoxy)phenyl]-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium.
| Compound Name | 1-(2,2-difluoroethyl)-2-[2-fluoro-6-(methylsulfanylmethoxy)phenyl]-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium |
|---|---|
| PubChem CID | 160713949 |
| Molecular Formula | C17H17F3NOSY- |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | 1-(2,2-difluoroethyl)-2-[2-fluoro-6-(methylsulfanylmethoxy)phenyl]-5-methyl-6-methylidene-3H-pyridin-3-ide;yttrium |
| SMILES | C=C1C(C)=C[C-]=C(c2c(F)cccc2OCSC)N1CC(F)F.[Y] |
| InChI | InChI=1S/C17H17F3NOS.Y/c1-11-7-8-14(21(12(11)2)9-16(19)20)17-13(18)5-4-6-15(17)22-10-23-3;/h4-7,16H,2,9-10H2,1,3H3;/q-1; |
| InChIKey | SKORTXVPILPXGS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|