C29H26IN3OS2 — CID 159962298
5-[(2S)-2-[4-[[2-iodo-3-(2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]pent-3-ynyl]-4H-triazole;sulfane (PubChem CID 159962298) has the molecular formula C29H26IN3OS2 and a molecular weight of 623.59 g/mol. Its IUPAC name is 5-[(2S)-2-[4-[[2-iodo-3-(2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]pent-3-ynyl]-4H-triazole;sulfane.
| Compound Name | 5-[(2S)-2-[4-[[2-iodo-3-(2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]pent-3-ynyl]-4H-triazole;sulfane |
|---|---|
| PubChem CID | 159962298 |
| Molecular Formula | C29H26IN3OS2 |
| Molecular Weight | 623.59 g/mol |
| Exact Mass | 623.06 |
| IUPAC Name | 5-[(2S)-2-[4-[[2-iodo-3-(2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]pent-3-ynyl]-4H-triazole;sulfane |
| SMILES | CC#C[C@@H](CC1=NN=NC1)c1ccc(OCc2ccc3sc(I)c(-c4ccccc4C)c3c2)cc1.S |
| InChI | InChI=1S/C29H24IN3OS.H2S/c1-3-6-22(16-23-17-31-33-32-23)21-10-12-24(13-11-21)34-18-20-9-14-27-26(15-20)28(29(30)35-27)25-8-5-4-7-19(25)2;/h4-5,7-15,22H,16-18H2,1-2H3;1H2/t22-;/m0./s1 |
| InChIKey | ODMIJCVHZJIZKP-FTBISJDPSA-N |
| XLogP | 8.49 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.59 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|