C28H23ClN4OS — CID 131986297
5-[(2S)-2-[4-[[7-chloro-3-(2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]pent-3-ynyl]-2H-tetrazole (PubChem CID 131986297) has the molecular formula C28H23ClN4OS and a molecular weight of 499.04 g/mol. Its IUPAC name is 5-[(2S)-2-[4-[[7-chloro-3-(2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]pent-3-ynyl]-2H-tetrazole.
| Compound Name | 5-[(2S)-2-[4-[[7-chloro-3-(2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]pent-3-ynyl]-2H-tetrazole |
|---|---|
| PubChem CID | 131986297 |
| Molecular Formula | C28H23ClN4OS |
| Molecular Weight | 499.04 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 5-[(2S)-2-[4-[[7-chloro-3-(2-methylphenyl)-1-benzothiophen-5-yl]methoxy]phenyl]pent-3-ynyl]-2H-tetrazole |
| SMILES | CC#C[C@@H](Cc1nn[nH]n1)c1ccc(OCc2cc(Cl)c3scc(-c4ccccc4C)c3c2)cc1 |
| InChI | InChI=1S/C28H23ClN4OS/c1-3-6-21(15-27-30-32-33-31-27)20-9-11-22(12-10-20)34-16-19-13-24-25(17-35-28(24)26(29)14-19)23-8-5-4-7-18(23)2/h4-5,7-14,17,21H,15-16H2,1-2H3,(H,30,31,32,33)/t21-/m0/s1 |
| InChIKey | FADOGGGPIRBGHD-NRFANRHFSA-N |
| XLogP | 6.97 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.04 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|