C25H28N2O3 — CID 90133077
(3S)-3-[4-[[1-(3-methylbutyl)indazol-5-yl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 90133077) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is (3S)-3-[4-[[1-(3-methylbutyl)indazol-5-yl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[[1-(3-methylbutyl)indazol-5-yl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 90133077 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | (3S)-3-[4-[[1-(3-methylbutyl)indazol-5-yl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCc2ccc3c(cnn3CCC(C)C)c2)cc1 |
| InChI | InChI=1S/C25H28N2O3/c1-4-5-21(15-25(28)29)20-7-9-23(10-8-20)30-17-19-6-11-24-22(14-19)16-26-27(24)13-12-18(2)3/h6-11,14,16,18,21H,12-13,15,17H2,1-3H3,(H,28,29)/t21-/m0/s1 |
| InChIKey | TXSUHWQKPYRRNR-NRFANRHFSA-N |
| XLogP | 5.24 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|