C26H31NO5 — CID 158780540
formic acid;(3S)-3-[4-[[3-(piperidin-1-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 158780540) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is formic acid;(3S)-3-[4-[[3-(piperidin-1-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | formic acid;(3S)-3-[4-[[3-(piperidin-1-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 158780540 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | formic acid;(3S)-3-[4-[[3-(piperidin-1-ylmethyl)phenyl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCc2cccc(CN3CCCCC3)c2)cc1.O=CO |
| InChI | InChI=1S/C25H29NO3.CH2O2/c1-2-7-23(17-25(27)28)22-10-12-24(13-11-22)29-19-21-9-6-8-20(16-21)18-26-14-4-3-5-15-26;2-1-3/h6,8-13,16,23H,3-5,14-15,17-19H2,1H3,(H,27,28);1H,(H,2,3)/t23-;/m0./s1 |
| InChIKey | IRAGHCWODIWYBL-BQAIUKQQSA-N |
| XLogP | 4.53 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|