C25H27NO5 — CID 123570252
3-[4-[[3-[formyloxy(pyrrolidin-1-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 123570252) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is 3-[4-[[3-[formyloxy(pyrrolidin-1-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[[3-[formyloxy(pyrrolidin-1-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 123570252 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 3-[4-[[3-[formyloxy(pyrrolidin-1-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OCc2cccc(C(OC=O)N3CCCC3)c2)cc1 |
| InChI | InChI=1S/C25H27NO5/c1-2-6-21(16-24(28)29)20-9-11-23(12-10-20)30-17-19-7-5-8-22(15-19)25(31-18-27)26-13-3-4-14-26/h5,7-12,15,18,21,25H,3-4,13-14,16-17H2,1H3,(H,28,29) |
| InChIKey | ISNLTQMDCGRZIU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|