C31H34N2O3 — CID 134501881
(4S)-4-[4-[[3-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]methoxy]phenyl]hept-5-yn-2-one (PubChem CID 134501881) has the molecular formula C31H34N2O3 and a molecular weight of 482.62 g/mol. Its IUPAC name is (4S)-4-[4-[[3-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]methoxy]phenyl]hept-5-yn-2-one.
| Compound Name | (4S)-4-[4-[[3-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]methoxy]phenyl]hept-5-yn-2-one |
|---|---|
| PubChem CID | 134501881 |
| Molecular Formula | C31H34N2O3 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | (4S)-4-[4-[[3-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]methoxy]phenyl]hept-5-yn-2-one |
| SMILES | CC#C[C@@H](CC(C)=O)c1ccc(OCc2cccc(N3CCN(c4ccc(OC)cc4)CC3)c2)cc1 |
| InChI | InChI=1S/C31H34N2O3/c1-4-6-27(21-24(2)34)26-9-13-31(14-10-26)36-23-25-7-5-8-29(22-25)33-19-17-32(18-20-33)28-11-15-30(35-3)16-12-28/h5,7-16,22,27H,17-21,23H2,1-3H3/t27-/m0/s1 |
| InChIKey | GANQMNMWJMUFOQ-MHZLTWQESA-N |
| XLogP | 5.69 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|