C54H56N4O6S2 — CID 122511122
(3S)-3-[4-[[3-[(2-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 122511122) has the molecular formula C54H56N4O6S2 and a molecular weight of 921.20 g/mol. Its IUPAC name is (3S)-3-[4-[[3-[(2-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | (3S)-3-[4-[[3-[(2-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 122511122 |
| Molecular Formula | C54H56N4O6S2 |
| Molecular Weight | 921.20 g/mol |
| Exact Mass | 920.36 |
| IUPAC Name | (3S)-3-[4-[[3-[(2-methyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-5-yl)methyl]phenyl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#C[C@@H](CC(=O)O)c1ccc(OCc2cccc(CN3CCc4sc(C)nc4C3)c2)cc1.CC#C[C@@H](CC(=O)O)c1ccc(OCc2cccc(CN3CCc4sc(C)nc4C3)c2)cc1 |
| InChI | InChI=1S/2C27H28N2O3S/c2*1-3-5-23(15-27(30)31)22-8-10-24(11-9-22)32-18-21-7-4-6-20(14-21)16-29-13-12-26-25(17-29)28-19(2)33-26/h2*4,6-11,14,23H,12-13,15-18H2,1-2H3,(H,30,31)/t2*23-/m00/s1 |
| InChIKey | MSNGILBUUAPGKM-MGRJJKNYSA-N |
| XLogP | 10.34 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.20 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|