C12H21N3 — CID 177244096
ethane;4-methanimidoyl-3-N-propan-2-ylbenzene-1,3-diamine (PubChem CID 177244096) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is ethane;4-methanimidoyl-3-N-propan-2-ylbenzene-1,3-diamine.
| Compound Name | ethane;4-methanimidoyl-3-N-propan-2-ylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 177244096 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | ethane;4-methanimidoyl-3-N-propan-2-ylbenzene-1,3-diamine |
| SMILES | CC.[H]/N=C/c1ccc(N)cc1NC(C)C |
| InChI | InChI=1S/C10H15N3.C2H6/c1-7(2)13-10-5-9(12)4-3-8(10)6-11;1-2/h3-7,11,13H,12H2,1-2H3;1-2H3/b11-6+; |
| InChIKey | MEPIMEHFXPEIKU-ICSBZGNSSA-N |
| XLogP | 3.11 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|