C19H25N5O2 — CID 142337965
2-methanimidoyl-5-[5-(1-oxa-7-azaspiro[3.5]nonan-7-yl)-1,2,4-oxadiazol-3-yl]-N-propan-2-ylaniline (PubChem CID 142337965) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 2-methanimidoyl-5-[5-(1-oxa-7-azaspiro[3.5]nonan-7-yl)-1,2,4-oxadiazol-3-yl]-N-propan-2-ylaniline.
| Compound Name | 2-methanimidoyl-5-[5-(1-oxa-7-azaspiro[3.5]nonan-7-yl)-1,2,4-oxadiazol-3-yl]-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 142337965 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 2-methanimidoyl-5-[5-(1-oxa-7-azaspiro[3.5]nonan-7-yl)-1,2,4-oxadiazol-3-yl]-N-propan-2-ylaniline |
| SMILES | [H]/N=C/c1ccc(-c2noc(N3CCC4(CCO4)CC3)n2)cc1NC(C)C |
| InChI | InChI=1S/C19H25N5O2/c1-13(2)21-16-11-14(3-4-15(16)12-20)17-22-18(26-23-17)24-8-5-19(6-9-24)7-10-25-19/h3-4,11-13,20-21H,5-10H2,1-2H3/b20-12+ |
| InChIKey | KNQHEOCCRSMLFH-UDWIEESQSA-N |
| XLogP | 3.31 |
| TPSA | 87.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|