C11H17N3S — CID 143805728
(2S)-1-N-(2-methanimidoyl-5-methylsulfanylphenyl)propane-1,2-diamine (PubChem CID 143805728) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is (2S)-1-N-(2-methanimidoyl-5-methylsulfanylphenyl)propane-1,2-diamine.
| Compound Name | (2S)-1-N-(2-methanimidoyl-5-methylsulfanylphenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 143805728 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | (2S)-1-N-(2-methanimidoyl-5-methylsulfanylphenyl)propane-1,2-diamine |
| SMILES | [H]/N=C/c1ccc(SC)cc1NC[C@H](C)N |
| InChI | InChI=1S/C11H17N3S/c1-8(13)7-14-11-5-10(15-2)4-3-9(11)6-12/h3-6,8,12,14H,7,13H2,1-2H3/b12-6+/t8-/m0/s1 |
| InChIKey | YXTRDQPFRJUFPZ-UGZWPXFQSA-N |
| XLogP | 2.17 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|