C8H12N2S2 — CID 130894221
[2,5-bis(methylsulfanyl)phenyl]hydrazine (PubChem CID 130894221) has the molecular formula C8H12N2S2 and a molecular weight of 200.33 g/mol. Its IUPAC name is [2,5-bis(methylsulfanyl)phenyl]hydrazine.
| Compound Name | [2,5-bis(methylsulfanyl)phenyl]hydrazine |
|---|---|
| PubChem CID | 130894221 |
| Molecular Formula | C8H12N2S2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | [2,5-bis(methylsulfanyl)phenyl]hydrazine |
| SMILES | CSc1ccc(SC)c(NN)c1 |
| InChI | InChI=1S/C8H12N2S2/c1-11-6-3-4-8(12-2)7(5-6)10-9/h3-5,10H,9H2,1-2H3 |
| InChIKey | PEDGRVTVDCMVJZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|