C8H9NaS3 — CID 20706932
sodium 2,4-bis(methylsulfanyl)benzenethiolate (PubChem CID 20706932) has the molecular formula C8H9NaS3 and a molecular weight of 224.35 g/mol. Its IUPAC name is sodium 2,4-bis(methylsulfanyl)benzenethiolate.
| Compound Name | sodium 2,4-bis(methylsulfanyl)benzenethiolate |
|---|---|
| PubChem CID | 20706932 |
| Molecular Formula | C8H9NaS3 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 223.98 |
| IUPAC Name | sodium 2,4-bis(methylsulfanyl)benzenethiolate |
| SMILES | CSc1ccc([S-])c(SC)c1.[Na+] |
| InChI | InChI=1S/C8H10S3.Na/c1-10-6-3-4-7(9)8(5-6)11-2;/h3-5,9H,1-2H3;/q;+1/p-1 |
| InChIKey | VQHBBOLZURWSMG-UHFFFAOYSA-M |
| XLogP | 0.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|