C9H12OS2 — CID 54501035
[2,4-bis(methylsulfanyl)phenyl]methanol (PubChem CID 54501035) has the molecular formula C9H12OS2 and a molecular weight of 200.33 g/mol. Its IUPAC name is [2,4-bis(methylsulfanyl)phenyl]methanol.
| Compound Name | [2,4-bis(methylsulfanyl)phenyl]methanol |
|---|---|
| PubChem CID | 54501035 |
| Molecular Formula | C9H12OS2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | [2,4-bis(methylsulfanyl)phenyl]methanol |
| SMILES | CSc1ccc(CO)c(SC)c1 |
| InChI | InChI=1S/C9H12OS2/c1-11-8-4-3-7(6-10)9(5-8)12-2/h3-5,10H,6H2,1-2H3 |
| InChIKey | GONBIQYNOZNODP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |