C13H20N2S2 — CID 117424931
1-[[2,4-bis(methylsulfanyl)phenyl]methyl]piperazine (PubChem CID 117424931) has the molecular formula C13H20N2S2 and a molecular weight of 268.45 g/mol. Its IUPAC name is 1-[[2,4-bis(methylsulfanyl)phenyl]methyl]piperazine.
| Compound Name | 1-[[2,4-bis(methylsulfanyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 117424931 |
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-[[2,4-bis(methylsulfanyl)phenyl]methyl]piperazine |
| SMILES | CSc1ccc(CN2CCNCC2)c(SC)c1 |
| InChI | InChI=1S/C13H20N2S2/c1-16-12-4-3-11(13(9-12)17-2)10-15-7-5-14-6-8-15/h3-4,9,14H,5-8,10H2,1-2H3 |
| InChIKey | DRCTYUASCWXYSO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |