C14H22N2S — CID 82264824
1-[(4-propan-2-ylsulfanylphenyl)methyl]piperazine (PubChem CID 82264824) has the molecular formula C14H22N2S and a molecular weight of 250.41 g/mol. Its IUPAC name is 1-[(4-propan-2-ylsulfanylphenyl)methyl]piperazine.
| Compound Name | 1-[(4-propan-2-ylsulfanylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 82264824 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-[(4-propan-2-ylsulfanylphenyl)methyl]piperazine |
| SMILES | CC(C)Sc1ccc(CN2CCNCC2)cc1 |
| InChI | InChI=1S/C14H22N2S/c1-12(2)17-14-5-3-13(4-6-14)11-16-9-7-15-8-10-16/h3-6,12,15H,7-11H2,1-2H3 |
| InChIKey | KFOUWSFPPCBTOS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |